CAS 832737-87-8 appears in our catalog under these names: 5-[(2-Chloro-6-methylphenoxy)methyl]-2-furoic acid, 95%, 5-((2-Chloro-6-methylphenoxy)methyl)furan-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxylic acid (CAS 832737-87-8) is a chemical compound with the molecular formula C13H11ClO4 and a molecular weight of 266.67 g/mol. IUPAC name: 5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: IJRZZPXUKJUXDF-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO4 |
|---|---|
| Molecular weight | 266.67 g/mol |
| IUPAC name | 5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | IJRZZPXUKJUXDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)OCC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)