Products 365414-83-1
CAS 365414-83-1 is the registry number for Avocadene Acetate. Offered by: TRC. Available pack sizes: 75mg.
Ethyl (1R,2S)-2-(dimethylamino)-5-oxo-1-phenylcyclohex-3-ene-1-carboxylate (CAS 365414-83-1) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: ethyl (1R,2S)-2-(dimethylamino)-5-oxo-1-phenylcyclohex-3-ene-1-carboxylate. InChIKey: HLVLGEYTTCYNDS-DOTOQJQBSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ethyl (1R,2S)-2-(dimethylamino)-5-oxo-1-phenylcyclohex-3-ene-1-carboxylate |
| InChIKey | HLVLGEYTTCYNDS-DOTOQJQBSA-N |
| SMILES | CCOC(=O)[C@]1(CC(=O)C=C[C@@H]1N(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)