CAS 365442-14-4 appears in our catalog under these names: (2R)-2-([(tert-Butoxy)carbonyl]amino)-2-phenylpropanoic acid, 95%, (2R)-2-(((tert-Butoxy)carbonyl)amino)-2-phenylpropanoic acid, (R)-2-((tert-Butoxycarbonyl)amino)-2-phenylpropanoic acid, 95%, 95%, (R)-2-(BOC-AMINO)-2-PHENYLPROPANOIC ACID, 98%, Boc-α-Me-D-Phg-OH, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid (CAS 365442-14-4) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid. InChIKey: WOGUASPHMADVMU-CQSZACIVSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid |
| InChIKey | WOGUASPHMADVMU-CQSZACIVSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)