CAS 365543-23-3 is the registry number for 2-(2-Benzo(1,3)dioxol-5-yl-vinyl)-6-hydroxy-benzoic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 50mg.
Ethyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-hydroxybenzoate (CAS 365543-23-3) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: ethyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-hydroxybenzoate. InChIKey: UHSRRFXIDYKERM-SOFGYWHQSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | ethyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-hydroxybenzoate |
| InChIKey | UHSRRFXIDYKERM-SOFGYWHQSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1O)/C=C/C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)