Products 365543-23-3

CAS 365543-23-3 is the registry number for 2-(2-Benzo(1,3)dioxol-5-yl-vinyl)-6-hydroxy-benzoic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-hydroxybenzoate (CAS 365543-23-3) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: ethyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-hydroxybenzoate. InChIKey: UHSRRFXIDYKERM-SOFGYWHQSA-N.

Identity
Molecular formulaC18H16O5
Molecular weight312.3 g/mol
IUPAC nameethyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-hydroxybenzoate
InChIKeyUHSRRFXIDYKERM-SOFGYWHQSA-N
SMILESCCOC(=O)C1=C(C=CC=C1O)/C=C/C2=CC3=C(C=C2)OCO3

Computed by PubChem (NCBI)