CAS 3663-81-8 appears in our catalog under these names: 2,3-Dihydro-1,4-benzodioxine-2-carbonyl chloride, 95%, 2,3-Dihydrobenzo[1,4]dioxine-2-carbonyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride (CAS 3663-81-8) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride. InChIKey: UPCGTFBXZKCPOT-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride |
| InChIKey | UPCGTFBXZKCPOT-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)Cl |
Computed by PubChem (NCBI)