Products 3663-81-8

CAS 3663-81-8 appears in our catalog under these names: 2,3-Dihydro-1,4-benzodioxine-2-carbonyl chloride, 95%, 2,3-Dihydrobenzo[1,4]dioxine-2-carbonyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.

2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride (CAS 3663-81-8) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride. InChIKey: UPCGTFBXZKCPOT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClO3
Molecular weight198.60 g/mol
IUPAC name2,3-dihydro-1,4-benzodioxine-3-carbonyl chloride
InChIKeyUPCGTFBXZKCPOT-UHFFFAOYSA-N
SMILESC1C(OC2=CC=CC=C2O1)C(=O)Cl

Computed by PubChem (NCBI)