CAS 366791-32-4 is the registry number for BDE NO 126 SOLUTION OEKANAL, 505G/ML IN. Offered by: Sigma-Aldrich. Available pack sizes: 1ML.
1,2,3-tribromo-5-(3,4-dibromophenoxy)benzene (CAS 366791-32-4) is a chemical compound with the molecular formula C12H5Br5O and a molecular weight of 564.7 g/mol. IUPAC name: 1,2,3-tribromo-5-(3,4-dibromophenoxy)benzene. InChIKey: SJNIIWPIAVQNRK-UHFFFAOYSA-N.
| Molecular formula | C12H5Br5O |
|---|---|
| Molecular weight | 564.7 g/mol |
| IUPAC name | 1,2,3-tribromo-5-(3,4-dibromophenoxy)benzene |
| InChIKey | SJNIIWPIAVQNRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=CC(=C(C(=C2)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)