Products 446254-68-8
CAS 446254-68-8 is the registry number for PBDE 104. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
1,3,5-tribromo-2-(2,6-dibromophenoxy)benzene (CAS 446254-68-8) is a chemical compound with the molecular formula C12H5Br5O and a molecular weight of 564.7 g/mol. IUPAC name: 1,3,5-tribromo-2-(2,6-dibromophenoxy)benzene. InChIKey: CRSCWEYUPUKHPI-UHFFFAOYSA-N.
| Molecular formula | C12H5Br5O |
|---|---|
| Molecular weight | 564.7 g/mol |
| IUPAC name | 1,3,5-tribromo-2-(2,6-dibromophenoxy)benzene |
| InChIKey | CRSCWEYUPUKHPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OC2=C(C=C(C=C2Br)Br)Br)Br |
Computed by PubChem (NCBI)