CAS 3671-60-1 appears in our catalog under these names: 5-Bromo-2-(trifluoromethyl)-1h-benzimidazole, 97%, 6-Bromo-2-trifluoromethyl-1h-benzoimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-2-(trifluoromethyl)-1H-benzimidazole (CAS 3671-60-1) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)-1H-benzimidazole. InChIKey: FKSDCMMCSWXZLS-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | FKSDCMMCSWXZLS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)