CAS 36714-84-8 is the registry number for N,N,2-Trimethyl-5-nitroaniline. Offered by: TRC. Available pack sizes: 2,5g.
N,N,2-trimethyl-5-nitroaniline (CAS 36714-84-8) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: N,N,2-trimethyl-5-nitroaniline. InChIKey: BYNBHYLLYPVADZ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | N,N,2-trimethyl-5-nitroaniline |
| InChIKey | BYNBHYLLYPVADZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N(C)C |
Computed by PubChem (NCBI)