Products 599178-70-8
CAS 599178-70-8 appears in our catalog under these names: N-Acetyl-3-cyano-L-phenylalanine, 98%, (S)-2-Acetamido-3-(3-cyanophenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
(2S)-2-acetamido-3-(3-cyanophenyl)propanoic acid (CAS 599178-70-8) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: (2S)-2-acetamido-3-(3-cyanophenyl)propanoic acid. InChIKey: ODSLGEVQHKOHHK-NSHDSACASA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(3-cyanophenyl)propanoic acid |
| InChIKey | ODSLGEVQHKOHHK-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC(=CC=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)