Products 3684-12-6
CAS 3684-12-6 appears in our catalog under these names: Anilino(phenyl)acetic acid, 95%, 2-Phenyl-2-(phenylamino)acetic acid, 97%, 97%, Phenyl-phenylamino-acetic acid, 95%, N-Phenyl-DL-Phg-OH, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
2-anilino-2-phenylacetic acid (CAS 3684-12-6) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 2-anilino-2-phenylacetic acid. InChIKey: NFEVMRNCAGDLBK-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2-anilino-2-phenylacetic acid |
| InChIKey | NFEVMRNCAGDLBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
phenyl(phenylamino)acetic acid, alpha-(Phenylamino)benzeneacetic acid, anilino(phenyl)acetic acid, 2-phenyl-2-(phenylamino)acetic acid, 2-Anilino-2-phenylacetic acid, Phenyl-phenylamino-acetic acid, N,2-Diphenylglycine, N,alpha-Diphenylglycine, N,alpha-Diphenylglycine; N-Phenyl-2-phenylglycine; NSC 3335, n,2-diphenyl-glycin