CAS 368441-44-5 appears in our catalog under these names: 2-tert-Butyl 5-methyl isoindoline-2,5-dicarboxylate, 95%, 2-tert-Butyl 5-methyl isoindoline-2,5-dicarboxylate, 95+%, 2-Tert-Butyl 5-Methyl Isoindoline-2,5-Dicarboxylate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g.
2-O-tert-butyl 5-O-methyl 1,3-dihydroisoindole-2,5-dicarboxylate (CAS 368441-44-5) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 1,3-dihydroisoindole-2,5-dicarboxylate. InChIKey: YPRDEEKSHOAQTH-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-methyl 1,3-dihydroisoindole-2,5-dicarboxylate |
| InChIKey | YPRDEEKSHOAQTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)