Products 36913-04-9
CAS 36913-04-9 appears in our catalog under these names: (S)-N,N-Dimethyl Amphetamine Hydrochloride, >95% (HPLC), (S)-N,N-Dimethyl Amphetamine Hydrochloride (1mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 2,5mg, 25mg, 1x1ml.
(2S)-N,N-dimethyl-1-phenylpropan-2-amine;hydrochloride (CAS 36913-04-9) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (2S)-N,N-dimethyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: UTWYKDPIWNRKCN-PPHPATTJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (2S)-N,N-dimethyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | UTWYKDPIWNRKCN-PPHPATTJSA-N |
| SMILES | C[C@@H](CC1=CC=CC=C1)N(C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
DIMETAMFETAMINE HYDROCHLORIDE, (S)-N,N,alpha-Trimethylphenethylamine hydrochloride, (S)-N,N-Dimethyl Amphetamine Hydrochloride (1mg/ml in Acetonitrile), (S)-N,N-Dimethyl Amphetamine Hydrochloride, DIMETHAMPHETAMINE HYDROCHLORIDE, L-DIMETHYLAMPHETAMINE HYDROCHLORIDE, DIMETAMFETAMINE HYDROCHLORIDE [WHO-DD], (2S)-N,N-Dimethyl-1-phenylpropan-2-amine--hydrogen chloride (1/1), PHENETHYLAMINE, N,N,.ALPHA.-TRIMETHYL-, HYDROCHLORIDE, (S)-, (S)-N,N-Dimethyl Amphetamine Hydrochloride (1 mg/ml in Acetonitrile)