Products 36913-13-0
CAS 36913-13-0 is the registry number for (S)-N,N-Dimethyl Amphetamine-d6 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2S)-1-phenyl-N,N-bis(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 36913-13-0) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 205.76 g/mol. IUPAC name: (2S)-1-phenyl-N,N-bis(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: UTWYKDPIWNRKCN-QAWCBLRGSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 205.76 g/mol |
| IUPAC name | (2S)-1-phenyl-N,N-bis(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | UTWYKDPIWNRKCN-QAWCBLRGSA-N |
| SMILES | [2H]C([2H])([2H])N([C@@H](C)CC1=CC=CC=C1)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)