CAS 3693-22-9 appears in our catalog under these names: Dibenzo(b,d)furan–2–amine, 2-Dibenzofuranamine, >98.0%(GC)(T), Dibenzo[b,d]furan-2-amine 95%, Dibenzo[b,d]furan-2-amine, 95%, 95%, 2-DIBENZOFURANAMINE, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 25g, 250mg, 10g.
Dibenzofuran-2-amine (CAS 3693-22-9) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: dibenzofuran-2-amine. InChIKey: FFYZMBQLAYDJIG-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | dibenzofuran-2-amine |
| InChIKey | FFYZMBQLAYDJIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)