CAS 369363-62-2 appears in our catalog under these names: 4-(4-(Trifluoromethyl)phenyl)-1H-1,2,3-triazole, 98%, 4-(4-(Trifluoromethyl)phenyl)-1H-1,2,3-triazole, 98%, 98%. Offered by: Chemat Brand, Chemat, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-[4-(trifluoromethyl)phenyl]-2H-triazole (CAS 369363-62-2) is a chemical compound with the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]-2H-triazole. InChIKey: NCZGZQWRTIFQKA-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]-2H-triazole |
| InChIKey | NCZGZQWRTIFQKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=C2)C(F)(F)F |
Computed by PubChem (NCBI)