Products 929635-73-4
CAS 929635-73-4 is the registry number for 5-(2,4,5-Trifluorophenyl)-1H-pyrazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4,5-trifluorophenyl)-1H-pyrazol-3-amine (CAS 929635-73-4) is a chemical compound with the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. IUPAC name: 5-(2,4,5-trifluorophenyl)-1H-pyrazol-3-amine. InChIKey: RYGQDKXEEWRDEY-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 5-(2,4,5-trifluorophenyl)-1H-pyrazol-3-amine |
| InChIKey | RYGQDKXEEWRDEY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C2=CC(=NN2)N |
Computed by PubChem (NCBI)