CAS 95728-16-8 is the registry number for 5-(4-(Trifluoromethyl)phenyl)-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazole (CAS 95728-16-8) is a chemical compound with the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazole. InChIKey: OUBGWLWCINAEHO-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazole |
| InChIKey | OUBGWLWCINAEHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=NN2)C(F)(F)F |
Computed by PubChem (NCBI)