CAS 60406-64-6 is the registry number for 3-Phenyl-5-(trifluoromethyl)-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-phenyl-5-(trifluoromethyl)-1H-1,2,4-triazole (CAS 60406-64-6) is a chemical compound with the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. IUPAC name: 3-phenyl-5-(trifluoromethyl)-1H-1,2,4-triazole. InChIKey: DEVRZHXKHXGIIY-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 3-phenyl-5-(trifluoromethyl)-1H-1,2,4-triazole |
| InChIKey | DEVRZHXKHXGIIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)