CAS 3695-84-9 appears in our catalog under these names: METHYL ALPHA–CYANOCINNAMATE, Methyl 2-cyano-3-phenylacrylate 95%, Methyl 2-cyano-3-phenylacrylate, 95%, 95%, Methyl 2-cyano-3-phenylacrylate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Methyl (E)-2-cyano-3-phenylprop-2-enoate (CAS 3695-84-9) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: methyl (E)-2-cyano-3-phenylprop-2-enoate. InChIKey: XLNFLJOWTRDNCX-JXMROGBWSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | methyl (E)-2-cyano-3-phenylprop-2-enoate |
| InChIKey | XLNFLJOWTRDNCX-JXMROGBWSA-N |
| SMILES | COC(=O)/C(=C/C1=CC=CC=C1)/C#N |
Computed by PubChem (NCBI)