CAS 36963-50-5 appears in our catalog under these names: 4–Bromoisoquinolin–3–ol, 4-bromoisoquinolin-3-ol, 4-Bromoisoquinolin-3-ol 97%, 4-Bromoisoquinolin-3-ol, 97%, 97%, 4-bromo-2,3-dihydroisoquinolin-3-one, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 0,5g, 2g, 5g, 250mg.
4-bromo-2H-isoquinolin-3-one (CAS 36963-50-5) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-bromo-2H-isoquinolin-3-one. InChIKey: POFWHUZLFZOBFX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-bromo-2H-isoquinolin-3-one |
| InChIKey | POFWHUZLFZOBFX-UHFFFAOYSA-N |
| SMILES | C1=CC2=CNC(=O)C(=C2C=C1)Br |
Computed by PubChem (NCBI)