Products 37005-75-7
CAS 37005-75-7 appears in our catalog under these names: Cyclopentyl 4-aminobenzoate, 95%, Cyclopentyl 4-aminobenzoate hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Cyclopentyl 4-aminobenzoate;hydrochloride (CAS 37005-75-7) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: cyclopentyl 4-aminobenzoate;hydrochloride. InChIKey: GQVBLRYWPXCXMY-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | cyclopentyl 4-aminobenzoate;hydrochloride |
| InChIKey | GQVBLRYWPXCXMY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC(=O)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)