Products 3705-27-9
CAS 3705-27-9 appears in our catalog under these names: (S)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione, 95%, Vildagliptin Impurity 26, Cyclo(–Gly–Pro), Cyclo(Gly-L-Pro), Cyclo(-Gly-Pro). Offered by: Combi-blocks, Chemat Brand, GLPBio, TargetMol, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg, on request, 50mg, 500mg, 1000mg.
(8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 3705-27-9) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: OWOHLURDBZHNGG-YFKPBYRVSA-N.
| Molecular formula | C7H10N2O2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | OWOHLURDBZHNGG-YFKPBYRVSA-N |
| SMILES | C1C[C@H]2C(=O)NCC(=O)N2C1 |
Computed by PubChem (NCBI)