CAS 97011-16-0 is the registry number for Cyclo(Gly-Pro). Offered by: Creative Peptides, MedChemExpress. Available pack sizes: on request, Get quote.
(8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 97011-16-0) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: OWOHLURDBZHNGG-YFKPBYRVSA-N.
| Molecular formula | C7H10N2O2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | (8aS)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | OWOHLURDBZHNGG-YFKPBYRVSA-N |
| SMILES | C1C[C@H]2C(=O)NCC(=O)N2C1 |
Computed by PubChem (NCBI)