CAS 96193-26-9 appears in our catalog under these names: (R)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione, 95%, (R)–Hexahydropyrrolo(1,2–a)pyrazine–1,4–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(8aR)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 96193-26-9) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: (8aR)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: OWOHLURDBZHNGG-RXMQYKEDSA-N.
| Molecular formula | C7H10N2O2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | (8aR)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | OWOHLURDBZHNGG-RXMQYKEDSA-N |
| SMILES | C1C[C@@H]2C(=O)NCC(=O)N2C1 |
Computed by PubChem (NCBI)