CAS 371171-04-9 appears in our catalog under these names: 7-(3,4-Dimethoxyphenyl)imidazo(1,2-c)pyrimidin-5-ol, 97%, 7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-ol, 98%, 98%, 7-(3,4-DIMETHOXYPHENYL)IMIDAZO[1,2-C]PYRIMIDIN-5-OL, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
7-(3,4-dimethoxyphenyl)-6H-imidazo[1,2-c]pyrimidin-5-one (CAS 371171-04-9) is a chemical compound with the molecular formula C14H13N3O3 and a molecular weight of 271.27 g/mol. IUPAC name: 7-(3,4-dimethoxyphenyl)-6H-imidazo[1,2-c]pyrimidin-5-one. InChIKey: ILHZIBPAYVNPCB-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O3 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 7-(3,4-dimethoxyphenyl)-6H-imidazo[1,2-c]pyrimidin-5-one |
| InChIKey | ILHZIBPAYVNPCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC3=NC=CN3C(=O)N2)OC |
Computed by PubChem (NCBI)