CAS 37162-75-7 is the registry number for 5-Bromo-2,4-dimethoxy-β-methylnitrostyrene. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
1-bromo-2,4-dimethoxy-5-[(E)-2-nitroprop-1-enyl]benzene (CAS 37162-75-7) is a chemical compound with the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. IUPAC name: 1-bromo-2,4-dimethoxy-5-[(E)-2-nitroprop-1-enyl]benzene. InChIKey: XWABUAXWCXXWQE-QPJJXVBHSA-N.
| Molecular formula | C11H12BrNO4 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 1-bromo-2,4-dimethoxy-5-[(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | XWABUAXWCXXWQE-QPJJXVBHSA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1OC)OC)Br)/[N+](=O)[O-] |
Computed by PubChem (NCBI)