CAS 667413-07-2 is the registry number for 9-Methyl-1-oxo-6,7-dihydro-1h,5h-pyrido[3,2,1-ij]quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
7-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid (CAS 667413-07-2) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 7-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid. InChIKey: XNPKFSCSMWRSDJ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 7-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid |
| InChIKey | XNPKFSCSMWRSDJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C3C(=C1)C(=O)C(=CN3CCC2)C(=O)O |
Computed by PubChem (NCBI)