Products 371778-55-1
CAS 371778-55-1 is the registry number for JA-ACC, 99.00%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 50 mg, 100 mg, 25 mg.
1-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]cyclopropane-1-carboxylic acid (CAS 371778-55-1) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 1-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]cyclopropane-1-carboxylic acid. InChIKey: TVRBFBSVUYCAKT-OPVGQWETSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | 1-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]cyclopropane-1-carboxylic acid |
| InChIKey | TVRBFBSVUYCAKT-OPVGQWETSA-N |
| SMILES | CC/C=C\C[C@@H]1[C@H](CCC1=O)CC(=O)NC2(CC2)C(=O)O |
Computed by PubChem (NCBI)