Products 372198-42-0

CAS 372198-42-0 is the registry number for 4-methylpyridine-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-methylpyridine-3-sulfonyl chloride (CAS 372198-42-0) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 4-methylpyridine-3-sulfonyl chloride. InChIKey: OPYAPMZPZXAVTG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO2S
Molecular weight191.64 g/mol
IUPAC name4-methylpyridine-3-sulfonyl chloride
InChIKeyOPYAPMZPZXAVTG-UHFFFAOYSA-N
SMILESCC1=C(C=NC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)