CAS 3744-13-6 appears in our catalog under these names: 2-{((4-bromophenyl)carbamoyl)amino}acetic acid, 95%, 2-{((4-Bromophenyl)carbamoyl)amino}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[(4-bromophenyl)carbamoylamino]acetic acid (CAS 3744-13-6) is a chemical compound with the molecular formula C9H9BrN2O3 and a molecular weight of 273.08 g/mol. IUPAC name: 2-[(4-bromophenyl)carbamoylamino]acetic acid. InChIKey: MNYMVAJOBVMXML-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O3 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 2-[(4-bromophenyl)carbamoylamino]acetic acid |
| InChIKey | MNYMVAJOBVMXML-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NCC(=O)O)Br |
Computed by PubChem (NCBI)