Products 374565-57-8

CAS 374565-57-8 is the registry number for 5-(4-Methoxyphenoxy)pentanoic Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

5-(4-methoxyphenoxy)pentanoic acid (CAS 374565-57-8) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 5-(4-methoxyphenoxy)pentanoic acid. InChIKey: HFDHPEFKVYEQKK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O4
Molecular weight224.25 g/mol
IUPAC name5-(4-methoxyphenoxy)pentanoic acid
InChIKeyHFDHPEFKVYEQKK-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)OCCCCC(=O)O

Computed by PubChem (NCBI)