Products 37466-90-3
CAS 37466-90-3 appears in our catalog under these names: Ethyl 3,4–diaminobenzoate, 97%, Ethyl 3,4-diaminobenzoate, Ethyl 3,4-Diaminobenzoate, >98.0%(GC)(T), Ethyl 3,4-diaminobenzoate 97%, Ethyl 3,4-diaminobenzoate, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 10g, 5g, 50g, 1g, 500g, 250g.
Ethyl 3,4-diaminobenzoate (CAS 37466-90-3) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: ethyl 3,4-diaminobenzoate. InChIKey: NUJBTXFFJUGENN-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | ethyl 3,4-diaminobenzoate |
| InChIKey | NUJBTXFFJUGENN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)