CAS 374709-84-9 appears in our catalog under these names: 6-Methoxy-4-methylquinazolin-2-amine, 95+%, 6-Methoxy-4-methylquinazolin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,05g.
6-methoxy-4-methylquinazolin-2-amine (CAS 374709-84-9) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 6-methoxy-4-methylquinazolin-2-amine. InChIKey: OCKIKBXJWZGGOE-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6-methoxy-4-methylquinazolin-2-amine |
| InChIKey | OCKIKBXJWZGGOE-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=NC(=N1)N)OC |
Computed by PubChem (NCBI)