CAS 37522-29-5 appears in our catalog under these names: Apixaban Impurity 124, Ethyl 2-chloro-2-[2-(4-ethoxyphenyl)hydrazinylidene]acetate, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Ethyl (2Z)-2-chloro-2-[(4-ethoxyphenyl)hydrazinylidene]acetate (CAS 37522-29-5) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(4-ethoxyphenyl)hydrazinylidene]acetate. InChIKey: XIUUHZQUONNURX-PTNGSMBKSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(4-ethoxyphenyl)hydrazinylidene]acetate |
| InChIKey | XIUUHZQUONNURX-PTNGSMBKSA-N |
| SMILES | CCOC1=CC=C(C=C1)N/N=C(/C(=O)OCC)\Cl |
Computed by PubChem (NCBI)