CAS 3761-46-4 appears in our catalog under these names: 2-Hydroxy-2-phenyl-1H-indene-1,3(2H)-dione, PHENINDIONE IMPURITY 1, BRITISH PHARMACO. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 500mg, 5g, 1EA.
2-hydroxy-2-phenylindene-1,3-dione (CAS 3761-46-4) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 2-hydroxy-2-phenylindene-1,3-dione. InChIKey: FZNLKDSIHNSWTM-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-hydroxy-2-phenylindene-1,3-dione |
| InChIKey | FZNLKDSIHNSWTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)