Products 3761-58-8
CAS 3761-58-8 is the registry number for Candicine (chloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-hydroxyphenyl)ethyl-trimethylazanium chloride (CAS 3761-58-8) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 2-(4-hydroxyphenyl)ethyl-trimethylazanium chloride. InChIKey: RSMTVUYKCSQILZ-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)ethyl-trimethylazanium chloride |
| InChIKey | RSMTVUYKCSQILZ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCC1=CC=C(C=C1)O.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
CANDICINE CHLORIDE, maltoxin, 4-Hydroxy-N,N,N-trimethylbenzeneethanaminium chloride, Benzeneethanaminium, 4-hydroxy-N,N,N-trimethyl-, chloride, (P-HYDROXYPHENETHYL)TRIMETHYLAMMONIUM CHLORIDE, Candicine (chloride), 2-(4-Hydroxyphenyl)-N,N,N-trimethylethan-1-aminium chloride, orb3141596, (p-hydroxyphenethyl)-trimethylammonium chloride, [2-(4-hydroxyphenyl)ethyl]trimethylazanium chloride