CAS 376349-57-4 is the registry number for 4-(2,5-Dimethylfuran-3-yl)-1,3-thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-amine (CAS 376349-57-4) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-amine. InChIKey: RIDPPBQSUDEXBU-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-amine |
| InChIKey | RIDPPBQSUDEXBU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)