CAS 37662-06-9 appears in our catalog under these names: Ethyl (S)-2-((1-phenylethyl)imino)acetate, 98%, Ethyl L-(alpha-Methylbenzylimino)acetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Ethyl 2-[(1S)-1-phenylethyl]iminoacetate (CAS 37662-06-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: ethyl 2-[(1S)-1-phenylethyl]iminoacetate. InChIKey: VHFZIBNRJPBOBX-JTQLQIEISA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | ethyl 2-[(1S)-1-phenylethyl]iminoacetate |
| InChIKey | VHFZIBNRJPBOBX-JTQLQIEISA-N |
| SMILES | CCOC(=O)C=N[C@@H](C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)