CAS 376634-33-2 is the registry number for (E)-4,4,5,5-Tetramethyl-2-(2-((tetrahydro-2H-pyran-2-yl)oxy)vinyl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-[(E)-2-(oxan-2-yloxy)ethenyl]-1,3,2-dioxaborolane (CAS 376634-33-2) is a chemical compound with the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-2-(oxan-2-yloxy)ethenyl]-1,3,2-dioxaborolane. InChIKey: WJDDIQRCANTAON-CSKARUKUSA-N.
| Molecular formula | C13H23BO4 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-2-(oxan-2-yloxy)ethenyl]-1,3,2-dioxaborolane |
| InChIKey | WJDDIQRCANTAON-CSKARUKUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/OC2CCCCO2 |
Computed by PubChem (NCBI)