CAS 2375287-90-2 is the registry number for (E)-5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-1-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate (CAS 2375287-90-2) is a chemical compound with the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. IUPAC name: [(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate. InChIKey: PAVMLDCAKRJZGJ-VQHVLOKHSA-N.
| Molecular formula | C13H23BO4 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | [(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl] acetate |
| InChIKey | PAVMLDCAKRJZGJ-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCCOC(=O)C |
Computed by PubChem (NCBI)