Products 521950-37-8
CAS 521950-37-8 is the registry number for Methyl (5E)-6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-hexenoate. Offered by: TRC. Available pack sizes: 2,5g.
Methyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate (CAS 521950-37-8) is a chemical compound with the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. IUPAC name: methyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate. InChIKey: RCYSXSOFOYRLJA-CSKARUKUSA-N.
| Molecular formula | C13H23BO4 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | methyl (E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate |
| InChIKey | RCYSXSOFOYRLJA-CSKARUKUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCCC(=O)OC |
Computed by PubChem (NCBI)