CAS 2365173-88-0 is the registry number for Methyl 3-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)cyclobutane-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclobutane-1-carboxylate (CAS 2365173-88-0) is a chemical compound with the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. IUPAC name: methyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclobutane-1-carboxylate. InChIKey: UFQVYGHLNLMDMY-UHFFFAOYSA-N.
| Molecular formula | C13H23BO4 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | methyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclobutane-1-carboxylate |
| InChIKey | UFQVYGHLNLMDMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CC(C2)C(=O)OC |
Computed by PubChem (NCBI)