CAS 2851113-48-7 is the registry number for Isopropyl (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate (CAS 2851113-48-7) is a chemical compound with the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. IUPAC name: propan-2-yl (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate. InChIKey: RPSCPLHITOMZAO-CSKARUKUSA-N.
| Molecular formula | C13H23BO4 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | propan-2-yl (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate |
| InChIKey | RPSCPLHITOMZAO-CSKARUKUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C/C(=O)OC(C)C)/C |
Computed by PubChem (NCBI)