CAS 376641-58-6 appears in our catalog under these names: Cinacalcet Impurity 23, 2-(Trifluoromethyl)-Benzenepropanal. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
3-[2-(trifluoromethyl)phenyl]propanal (CAS 376641-58-6) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 3-[2-(trifluoromethyl)phenyl]propanal. InChIKey: ANZQTKJIALSFQK-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 3-[2-(trifluoromethyl)phenyl]propanal |
| InChIKey | ANZQTKJIALSFQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC=O)C(F)(F)F |
Computed by PubChem (NCBI)