Products 601513-31-9
CAS 601513-31-9 is the registry number for 4-Chloro-2-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[4-chloro-2-(trifluoromethyl)phenyl]acetic acid (CAS 601513-31-9) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: 2-[4-chloro-2-(trifluoromethyl)phenyl]acetic acid. InChIKey: UKSTVTZXWKFMHX-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 2-[4-chloro-2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | UKSTVTZXWKFMHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)