CAS 3783-38-8 appears in our catalog under these names: Topiroxostat Impurity 30, Methylisonicotinate–N–Oxide, 4-(Methoxycarbonyl)pyridine 1-oxide 95%, 4-(Methoxycarbonyl)Pyridine 1-Oxide, 95%, 95%, Methylisonicotinate-N-oxide, 95%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 25g, 5g, 1g, 100g, 10g.
Methyl 1-oxidopyridin-1-ium-4-carboxylate (CAS 3783-38-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: methyl 1-oxidopyridin-1-ium-4-carboxylate. InChIKey: XSGNXRNOZMUURC-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | methyl 1-oxidopyridin-1-ium-4-carboxylate |
| InChIKey | XSGNXRNOZMUURC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)