CAS 68931-30-6 appears in our catalog under these names: Geranyl–linalool (mixture of isomers), Geranyl-linalool (mixture of isomers), >90.0%(GC), 3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol, 97%, 97%, 3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol, 97.89%, 3,7,11,15-Tetramethylhexadeca-1,6,10,14-tetraen-3-ol, 97%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100ml, 25ml, 5ml, 1g, 5g, 10g, 25g, 100g.
3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol (CAS 68931-30-6) is a chemical compound with the molecular formula C20H34O and a molecular weight of 290.5 g/mol. IUPAC name: 3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol. InChIKey: IQDXAJNQKSIPGB-UHFFFAOYSA-N.
| Molecular formula | C20H34O |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | 3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol |
| InChIKey | IQDXAJNQKSIPGB-UHFFFAOYSA-N |
| SMILES | CC(=CCCC(=CCCC(=CCCC(C)(C=C)O)C)C)C |
Computed by PubChem (NCBI)