Products 379228-26-9
CAS 379228-26-9 appears in our catalog under these names: Methyl 2–amino–4，6–dimethoxybenzoate, Methyl 2-Amino-4,6-dimethoxybenzoate, Methyl 2-amino-4,6-dimethoxybenzoate 95%, Methyl 2-amino-4,6-dimethoxybenzoate, 95%, 95%, Methyl 2-amino-4,6-dimethoxybenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 2-amino-4,6-dimethoxybenzoate (CAS 379228-26-9) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: methyl 2-amino-4,6-dimethoxybenzoate. InChIKey: AXIFIORAYHVIGR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | methyl 2-amino-4,6-dimethoxybenzoate |
| InChIKey | AXIFIORAYHVIGR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)OC)N |
Computed by PubChem (NCBI)