Products 379254-20-3

CAS 379254-20-3 is the registry number for 4-(4-Chloro-3-methyl-phenoxymethyl)-benzoic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-[(4-chloro-3-methylphenoxy)methyl]benzohydrazide (CAS 379254-20-3) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: 4-[(4-chloro-3-methylphenoxy)methyl]benzohydrazide. InChIKey: FUORJFHDXZOCNA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15ClN2O2
Molecular weight290.74 g/mol
IUPAC name4-[(4-chloro-3-methylphenoxy)methyl]benzohydrazide
InChIKeyFUORJFHDXZOCNA-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)OCC2=CC=C(C=C2)C(=O)NN)Cl

Computed by PubChem (NCBI)